C15H17Cl2NiP — CID 174835679
dichloronickel;1,1-diphenylpropylphosphane (PubChem CID 174835679) has the molecular formula C15H17Cl2NiP and a molecular weight of 357.87 g/mol. Its IUPAC name is dichloronickel;1,1-diphenylpropylphosphane.
| Compound Name | dichloronickel;1,1-diphenylpropylphosphane |
|---|---|
| PubChem CID | 174835679 |
| Molecular Formula | C15H17Cl2NiP |
| Molecular Weight | 357.87 g/mol |
| Exact Mass | 355.98 |
| IUPAC Name | dichloronickel;1,1-diphenylpropylphosphane |
| SMILES | CCC(P)(c1ccccc1)c1ccccc1.Cl[Ni]Cl |
| InChI | InChI=1S/C15H17P.2ClH.Ni/c1-2-15(16,13-9-5-3-6-10-13)14-11-7-4-8-12-14;;;/h3-12H,2,16H2,1H3;2*1H;/q;;;+2/p-2 |
| InChIKey | SGZPMDDSWZJHEC-UHFFFAOYSA-L |
| XLogP | 5.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.87 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|