C12H12N3O3S2- — CID 174836879
[4-[(5-amino-3-methyl-1,2-thiazole-4-carbonyl)amino]phenyl]methanesulfinate (PubChem CID 174836879) has the molecular formula C12H12N3O3S2- and a molecular weight of 310.38 g/mol. Its IUPAC name is [4-[(5-amino-3-methyl-1,2-thiazole-4-carbonyl)amino]phenyl]methanesulfinate.
| Compound Name | [4-[(5-amino-3-methyl-1,2-thiazole-4-carbonyl)amino]phenyl]methanesulfinate |
|---|---|
| PubChem CID | 174836879 |
| Molecular Formula | C12H12N3O3S2- |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | [4-[(5-amino-3-methyl-1,2-thiazole-4-carbonyl)amino]phenyl]methanesulfinate |
| SMILES | Cc1nsc(N)c1C(=O)Nc1ccc(CS(=O)[O-])cc1 |
| InChI | InChI=1S/C12H13N3O3S2/c1-7-10(11(13)19-15-7)12(16)14-9-4-2-8(3-5-9)6-20(17)18/h2-5H,6,13H2,1H3,(H,14,16)(H,17,18)/p-1 |
| InChIKey | VRUPUCXOFBLUER-UHFFFAOYSA-M |
| XLogP | 1.67 |
| TPSA | 108.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|