C17H14FGeO5 — CID 174838255
CID 174838255 (PubChem CID 174838255) has the molecular formula C17H14FGeO5 and a molecular weight of 389.90 g/mol.
| Compound Name | CID 174838255 |
|---|---|
| PubChem CID | 174838255 |
| Molecular Formula | C17H14FGeO5 |
| Molecular Weight | 389.90 g/mol |
| Exact Mass | 391.00 |
| IUPAC Name | — |
| SMILES | COc1cc(OC)c(C(=O)O)c(CC(=O)c2ccc(F)cc2)c1[Ge] |
| InChI | InChI=1S/C17H14FGeO5/c1-23-13-8-14(24-2)16(19)11(15(13)17(21)22)7-12(20)9-3-5-10(18)6-4-9/h3-6,8H,7H2,1-2H3,(H,21,22) |
| InChIKey | ATMHHRBSCHACTP-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.90 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |