C5H9N3O2 — CID 174839011
(3-amino-1-cyanopropyl)carbamic acid (PubChem CID 174839011) has the molecular formula C5H9N3O2 and a molecular weight of 143.15 g/mol. Its IUPAC name is (3-amino-1-cyanopropyl)carbamic acid.
| Compound Name | (3-amino-1-cyanopropyl)carbamic acid |
|---|---|
| PubChem CID | 174839011 |
| Molecular Formula | C5H9N3O2 |
| Molecular Weight | 143.15 g/mol |
| Exact Mass | 143.07 |
| IUPAC Name | (3-amino-1-cyanopropyl)carbamic acid |
| SMILES | N#CC(CCN)NC(=O)O |
| InChI | InChI=1S/C5H9N3O2/c6-2-1-4(3-7)8-5(9)10/h4,8H,1-2,6H2,(H,9,10) |
| InChIKey | KRAXYFXWTUCCMI-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 99.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.15 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |