About pyridine;1-pyrrolidin-1-ylpiperazine
pyridine;1-pyrrolidin-1-ylpiperazine (PubChem CID 174842490) has the molecular formula C13H22N4
and a molecular weight of 234.35 g/mol. Its IUPAC name is pyridine;1-pyrrolidin-1-ylpiperazine.
Molecular Properties
| Compound Name | pyridine;1-pyrrolidin-1-ylpiperazine |
| PubChem CID | 174842490 |
| Molecular Formula | C13H22N4 |
| Molecular Weight | 234.35 g/mol |
| Exact Mass | 234.18 |
| IUPAC Name | pyridine;1-pyrrolidin-1-ylpiperazine |
| SMILES | C1CCN(N2CCNCC2)C1.c1ccncc1 |
| InChI | InChI=1S/C8H17N3.C5H5N/c1-2-6-10(5-1)11-7-3-9-4-8-11;1-2-4-6-5-3-1/h9H,1-8H2;1-5H |
| InChIKey | OYWFKYKPFJFAIJ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.35 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze pyridine;1-pyrrolidin-1-ylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridine;1-pyrrolidin-1-ylpiperazine?
The IUPAC name of pyridine;1-pyrrolidin-1-ylpiperazine (CID 174842490) is pyridine;1-pyrrolidin-1-ylpiperazine.
What is the SMILES notation for pyridine;1-pyrrolidin-1-ylpiperazine?
The canonical SMILES for pyridine;1-pyrrolidin-1-ylpiperazine is C1CCN(N2CCNCC2)C1.c1ccncc1.
What is the InChIKey of pyridine;1-pyrrolidin-1-ylpiperazine?
The InChIKey is OYWFKYKPFJFAIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N3.C5H5N/c1-2-6-10(5-1)11-7-3-9-4-8-11;1-2-4-6-5-3-1/h9H,1-8H2;1-5H.
What are the key properties of pyridine;1-pyrrolidin-1-ylpiperazine?
pyridine;1-pyrrolidin-1-ylpiperazine has a molecular weight of 234.35 g/mol, XLogP of 0.98, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyridine;1-pyrrolidin-1-ylpiperazine is sourced from PubChem (CID 174842490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).