About piperazin-1-ylurea;pyridine
piperazin-1-ylurea;pyridine (PubChem CID 174924246) has the molecular formula C10H17N5O
and a molecular weight of 223.28 g/mol. Its IUPAC name is piperazin-1-ylurea;pyridine.
Molecular Properties
| Compound Name | piperazin-1-ylurea;pyridine |
| PubChem CID | 174924246 |
| Molecular Formula | C10H17N5O |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | piperazin-1-ylurea;pyridine |
| SMILES | NC(=O)NN1CCNCC1.c1ccncc1 |
| InChI | InChI=1S/C5H12N4O.C5H5N/c6-5(10)8-9-3-1-7-2-4-9;1-2-4-6-5-3-1/h7H,1-4H2,(H3,6,8,10);1-5H |
| InChIKey | WXPVEHKAAHDKDV-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze piperazin-1-ylurea;pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperazin-1-ylurea;pyridine?
The IUPAC name of piperazin-1-ylurea;pyridine (CID 174924246) is piperazin-1-ylurea;pyridine.
What is the SMILES notation for piperazin-1-ylurea;pyridine?
The canonical SMILES for piperazin-1-ylurea;pyridine is NC(=O)NN1CCNCC1.c1ccncc1.
What is the InChIKey of piperazin-1-ylurea;pyridine?
The InChIKey is WXPVEHKAAHDKDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N4O.C5H5N/c6-5(10)8-9-3-1-7-2-4-9;1-2-4-6-5-3-1/h7H,1-4H2,(H3,6,8,10);1-5H.
What are the key properties of piperazin-1-ylurea;pyridine?
piperazin-1-ylurea;pyridine has a molecular weight of 223.28 g/mol, XLogP of -0.44, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for piperazin-1-ylurea;pyridine is sourced from PubChem (CID 174924246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).