C19H24N6O2 — CID 174379453
pyridin-3-yl 2-[[amino-(piperazin-1-ylamino)methylidene]amino]-3-phenylpropanoate (PubChem CID 174379453) has the molecular formula C19H24N6O2 and a molecular weight of 368.44 g/mol. Its IUPAC name is pyridin-3-yl 2-[[amino-(piperazin-1-ylamino)methylidene]amino]-3-phenylpropanoate.
| Compound Name | pyridin-3-yl 2-[[amino-(piperazin-1-ylamino)methylidene]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 174379453 |
| Molecular Formula | C19H24N6O2 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | pyridin-3-yl 2-[[amino-(piperazin-1-ylamino)methylidene]amino]-3-phenylpropanoate |
| SMILES | N/C(=N\C(Cc1ccccc1)C(=O)Oc1cccnc1)NN1CCNCC1 |
| InChI | InChI=1S/C19H24N6O2/c20-19(24-25-11-9-21-10-12-25)23-17(13-15-5-2-1-3-6-15)18(26)27-16-7-4-8-22-14-16/h1-8,14,17,21H,9-13H2,(H3,20,23,24) |
| InChIKey | JCMOUVMWFZEHPM-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 104.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|