C23H24N4O3 — CID 140578097
N-[(S)-(4-phenoxyphenyl)-pyridin-3-yloxymethyl]piperazine-1-carboxamide (PubChem CID 140578097) has the molecular formula C23H24N4O3 and a molecular weight of 404.47 g/mol. Its IUPAC name is N-[(S)-(4-phenoxyphenyl)-pyridin-3-yloxymethyl]piperazine-1-carboxamide.
| Compound Name | N-[(S)-(4-phenoxyphenyl)-pyridin-3-yloxymethyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 140578097 |
| Molecular Formula | C23H24N4O3 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | N-[(S)-(4-phenoxyphenyl)-pyridin-3-yloxymethyl]piperazine-1-carboxamide |
| SMILES | O=C(N[C@@H](Oc1cccnc1)c1ccc(Oc2ccccc2)cc1)N1CCNCC1 |
| InChI | InChI=1S/C23H24N4O3/c28-23(27-15-13-24-14-16-27)26-22(30-21-7-4-12-25-17-21)18-8-10-20(11-9-18)29-19-5-2-1-3-6-19/h1-12,17,22,24H,13-16H2,(H,26,28)/t22-/m0/s1 |
| InChIKey | AXOSHVMXVGQSNT-QFIPXVFZSA-N |
| XLogP | 3.57 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|