C20H20ClN5O2S — CID 140578045
N-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-pyridin-3-yloxymethyl]piperazine-1-carboxamide (PubChem CID 140578045) has the molecular formula C20H20ClN5O2S and a molecular weight of 429.93 g/mol. Its IUPAC name is N-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-pyridin-3-yloxymethyl]piperazine-1-carboxamide.
| Compound Name | N-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-pyridin-3-yloxymethyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 140578045 |
| Molecular Formula | C20H20ClN5O2S |
| Molecular Weight | 429.93 g/mol |
| Exact Mass | 429.10 |
| IUPAC Name | N-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-pyridin-3-yloxymethyl]piperazine-1-carboxamide |
| SMILES | O=C(NC(Oc1cccnc1)c1nc(-c2ccc(Cl)cc2)cs1)N1CCNCC1 |
| InChI | InChI=1S/C20H20ClN5O2S/c21-15-5-3-14(4-6-15)17-13-29-19(24-17)18(28-16-2-1-7-23-12-16)25-20(27)26-10-8-22-9-11-26/h1-7,12-13,18,22H,8-11H2,(H,25,27) |
| InChIKey | PEGVWFDAALYKNQ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.93 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|