C18H21FN4O2 — CID 140578150
N-[(3-fluoro-4-methylphenyl)-pyridin-3-yloxymethyl]piperazine-1-carboxamide (PubChem CID 140578150) has the molecular formula C18H21FN4O2 and a molecular weight of 344.39 g/mol. Its IUPAC name is N-[(3-fluoro-4-methylphenyl)-pyridin-3-yloxymethyl]piperazine-1-carboxamide.
| Compound Name | N-[(3-fluoro-4-methylphenyl)-pyridin-3-yloxymethyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 140578150 |
| Molecular Formula | C18H21FN4O2 |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | N-[(3-fluoro-4-methylphenyl)-pyridin-3-yloxymethyl]piperazine-1-carboxamide |
| SMILES | Cc1ccc(C(NC(=O)N2CCNCC2)Oc2cccnc2)cc1F |
| InChI | InChI=1S/C18H21FN4O2/c1-13-4-5-14(11-16(13)19)17(25-15-3-2-6-21-12-15)22-18(24)23-9-7-20-8-10-23/h2-6,11-12,17,20H,7-10H2,1H3,(H,22,24) |
| InChIKey | UIWHAPKABWEXNU-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|