C21H28N4O2 — CID 140578074
N-[(4-tert-butylphenyl)-pyridin-3-yloxymethyl]piperazine-1-carboxamide (PubChem CID 140578074) has the molecular formula C21H28N4O2 and a molecular weight of 368.48 g/mol. Its IUPAC name is N-[(4-tert-butylphenyl)-pyridin-3-yloxymethyl]piperazine-1-carboxamide.
| Compound Name | N-[(4-tert-butylphenyl)-pyridin-3-yloxymethyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 140578074 |
| Molecular Formula | C21H28N4O2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | N-[(4-tert-butylphenyl)-pyridin-3-yloxymethyl]piperazine-1-carboxamide |
| SMILES | CC(C)(C)c1ccc(C(NC(=O)N2CCNCC2)Oc2cccnc2)cc1 |
| InChI | InChI=1S/C21H28N4O2/c1-21(2,3)17-8-6-16(7-9-17)19(27-18-5-4-10-23-15-18)24-20(26)25-13-11-22-12-14-25/h4-10,15,19,22H,11-14H2,1-3H3,(H,24,26) |
| InChIKey | HEYCEDIUICEHSZ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|