C18H21ClN4O3 — CID 140578064
N-[(3-chloro-4-methoxyphenyl)-pyridin-3-yloxymethyl]piperazine-1-carboxamide (PubChem CID 140578064) has the molecular formula C18H21ClN4O3 and a molecular weight of 376.84 g/mol. Its IUPAC name is N-[(3-chloro-4-methoxyphenyl)-pyridin-3-yloxymethyl]piperazine-1-carboxamide.
| Compound Name | N-[(3-chloro-4-methoxyphenyl)-pyridin-3-yloxymethyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 140578064 |
| Molecular Formula | C18H21ClN4O3 |
| Molecular Weight | 376.84 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | N-[(3-chloro-4-methoxyphenyl)-pyridin-3-yloxymethyl]piperazine-1-carboxamide |
| SMILES | COc1ccc(C(NC(=O)N2CCNCC2)Oc2cccnc2)cc1Cl |
| InChI | InChI=1S/C18H21ClN4O3/c1-25-16-5-4-13(11-15(16)19)17(26-14-3-2-6-21-12-14)22-18(24)23-9-7-20-8-10-23/h2-6,11-12,17,20H,7-10H2,1H3,(H,22,24) |
| InChIKey | YNGNJQJRGQSGPH-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.84 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|