About N-[(3,4-dichlorophenyl)-pyridin-3-yloxymethyl]piperazine-1-carboxamide;dihydrochloride
N-[(3,4-dichlorophenyl)-pyridin-3-yloxymethyl]piperazine-1-carboxamide;dihydrochloride (PubChem CID 140578075) has the molecular formula C17H20Cl4N4O2
and a molecular weight of 454.19 g/mol. Its IUPAC name is N-[(3,4-dichlorophenyl)-pyridin-3-yloxymethyl]piperazine-1-carboxamide;dihydrochloride.
Molecular Properties
| Compound Name | N-[(3,4-dichlorophenyl)-pyridin-3-yloxymethyl]piperazine-1-carboxamide;dihydrochloride |
| PubChem CID | 140578075 |
| Molecular Formula | C17H20Cl4N4O2 |
| Molecular Weight | 454.19 g/mol |
| Exact Mass | 452.03 |
| IUPAC Name | N-[(3,4-dichlorophenyl)-pyridin-3-yloxymethyl]piperazine-1-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(NC(Oc1cccnc1)c1ccc(Cl)c(Cl)c1)N1CCNCC1 |
| InChI | InChI=1S/C17H18Cl2N4O2.2ClH/c18-14-4-3-12(10-15(14)19)16(25-13-2-1-5-21-11-13)22-17(24)23-8-6-20-7-9-23;;/h1-5,10-11,16,20H,6-9H2,(H,22,24);2*1H |
| InChIKey | YRZIMXUUXXVJNN-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 454.19 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-[(3,4-dichlorophenyl)-pyridin-3-yloxymethyl]piperazine-1-carboxamide;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3,4-dichlorophenyl)-pyridin-3-yloxymethyl]piperazine-1-carboxamide;dihydrochloride?
The IUPAC name of N-[(3,4-dichlorophenyl)-pyridin-3-yloxymethyl]piperazine-1-carboxamide;dihydrochloride (CID 140578075) is N-[(3,4-dichlorophenyl)-pyridin-3-yloxymethyl]piperazine-1-carboxamide;dihydrochloride.
What is the SMILES notation for N-[(3,4-dichlorophenyl)-pyridin-3-yloxymethyl]piperazine-1-carboxamide;dihydrochloride?
The canonical SMILES for N-[(3,4-dichlorophenyl)-pyridin-3-yloxymethyl]piperazine-1-carboxamide;dihydrochloride is Cl.Cl.O=C(NC(Oc1cccnc1)c1ccc(Cl)c(Cl)c1)N1CCNCC1.
What is the InChIKey of N-[(3,4-dichlorophenyl)-pyridin-3-yloxymethyl]piperazine-1-carboxamide;dihydrochloride?
The InChIKey is YRZIMXUUXXVJNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18Cl2N4O2.2ClH/c18-14-4-3-12(10-15(14)19)16(25-13-2-1-5-21-11-13)22-17(24)23-8-6-20-7-9-23;;/h1-5,10-11,16,20H,6-9H2,(H,22,24);2*1H.
What are the key properties of N-[(3,4-dichlorophenyl)-pyridin-3-yloxymethyl]piperazine-1-carboxamide;dihydrochloride?
N-[(3,4-dichlorophenyl)-pyridin-3-yloxymethyl]piperazine-1-carboxamide;dihydrochloride has a molecular weight of 454.19 g/mol, XLogP of 3.92, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3,4-dichlorophenyl)-pyridin-3-yloxymethyl]piperazine-1-carboxamide;dihydrochloride is sourced from PubChem (CID 140578075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).