C19H18Cl2F3N3O3 — CID 140523911
N-[(3,4-dichlorophenyl)-[4-(trifluoromethoxy)phenoxy]methyl]piperazine-1-carboxamide (PubChem CID 140523911) has the molecular formula C19H18Cl2F3N3O3 and a molecular weight of 464.27 g/mol. Its IUPAC name is N-[(3,4-dichlorophenyl)-[4-(trifluoromethoxy)phenoxy]methyl]piperazine-1-carboxamide.
| Compound Name | N-[(3,4-dichlorophenyl)-[4-(trifluoromethoxy)phenoxy]methyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 140523911 |
| Molecular Formula | C19H18Cl2F3N3O3 |
| Molecular Weight | 464.27 g/mol |
| Exact Mass | 463.07 |
| IUPAC Name | N-[(3,4-dichlorophenyl)-[4-(trifluoromethoxy)phenoxy]methyl]piperazine-1-carboxamide |
| SMILES | O=C(NC(Oc1ccc(OC(F)(F)F)cc1)c1ccc(Cl)c(Cl)c1)N1CCNCC1 |
| InChI | InChI=1S/C19H18Cl2F3N3O3/c20-15-6-1-12(11-16(15)21)17(26-18(28)27-9-7-25-8-10-27)29-13-2-4-14(5-3-13)30-19(22,23)24/h1-6,11,17,25H,7-10H2,(H,26,28) |
| InChIKey | MGZYLBAWHXCGPC-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.27 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|