About phenyl (2S)-3-phenyl-2-thionitrosopropanoate;hydrochloride
phenyl (2S)-3-phenyl-2-thionitrosopropanoate;hydrochloride (PubChem CID 88771740) has the molecular formula C15H14ClNO2S
and a molecular weight of 307.80 g/mol. Its IUPAC name is phenyl (2S)-3-phenyl-2-thionitrosopropanoate;hydrochloride.
Molecular Properties
| Compound Name | phenyl (2S)-3-phenyl-2-thionitrosopropanoate;hydrochloride |
| PubChem CID | 88771740 |
| Molecular Formula | C15H14ClNO2S |
| Molecular Weight | 307.80 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | phenyl (2S)-3-phenyl-2-thionitrosopropanoate;hydrochloride |
| SMILES | Cl.O=C(Oc1ccccc1)[C@H](Cc1ccccc1)N=S |
| InChI | InChI=1S/C15H13NO2S.ClH/c17-15(18-13-9-5-2-6-10-13)14(16-19)11-12-7-3-1-4-8-12;/h1-10,14H,11H2;1H/t14-;/m0./s1 |
| InChIKey | LZEXDMOZSBYUEZ-UQKRIMTDSA-N |
| XLogP | 3.36 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.80 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze phenyl (2S)-3-phenyl-2-thionitrosopropanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl (2S)-3-phenyl-2-thionitrosopropanoate;hydrochloride?
The IUPAC name of phenyl (2S)-3-phenyl-2-thionitrosopropanoate;hydrochloride (CID 88771740) is phenyl (2S)-3-phenyl-2-thionitrosopropanoate;hydrochloride.
What is the SMILES notation for phenyl (2S)-3-phenyl-2-thionitrosopropanoate;hydrochloride?
The canonical SMILES for phenyl (2S)-3-phenyl-2-thionitrosopropanoate;hydrochloride is Cl.O=C(Oc1ccccc1)[C@H](Cc1ccccc1)N=S.
What is the InChIKey of phenyl (2S)-3-phenyl-2-thionitrosopropanoate;hydrochloride?
The InChIKey is LZEXDMOZSBYUEZ-UQKRIMTDSA-N. The full InChI is InChI=1S/C15H13NO2S.ClH/c17-15(18-13-9-5-2-6-10-13)14(16-19)11-12-7-3-1-4-8-12;/h1-10,14H,11H2;1H/t14-;/m0./s1.
What are the key properties of phenyl (2S)-3-phenyl-2-thionitrosopropanoate;hydrochloride?
phenyl (2S)-3-phenyl-2-thionitrosopropanoate;hydrochloride has a molecular weight of 307.80 g/mol, XLogP of 3.36, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl (2S)-3-phenyl-2-thionitrosopropanoate;hydrochloride is sourced from PubChem (CID 88771740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).