About pyrrolidin-1-ylurea;hydrate
pyrrolidin-1-ylurea;hydrate (PubChem CID 141393036) has the molecular formula C5H13N3O2
and a molecular weight of 147.18 g/mol. Its IUPAC name is pyrrolidin-1-ylurea;hydrate.
Molecular Properties
| Compound Name | pyrrolidin-1-ylurea;hydrate |
| PubChem CID | 141393036 |
| Molecular Formula | C5H13N3O2 |
| Molecular Weight | 147.18 g/mol |
| Exact Mass | 147.10 |
| IUPAC Name | pyrrolidin-1-ylurea;hydrate |
| SMILES | NC(=O)NN1CCCC1.O |
| InChI | InChI=1S/C5H11N3O.H2O/c6-5(9)7-8-3-1-2-4-8;/h1-4H2,(H3,6,7,9);1H2 |
| InChIKey | PTWKEXYQYYEQKP-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 89.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.18 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze pyrrolidin-1-ylurea;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrrolidin-1-ylurea;hydrate?
The IUPAC name of pyrrolidin-1-ylurea;hydrate (CID 141393036) is pyrrolidin-1-ylurea;hydrate.
What is the SMILES notation for pyrrolidin-1-ylurea;hydrate?
The canonical SMILES for pyrrolidin-1-ylurea;hydrate is NC(=O)NN1CCCC1.O.
What is the InChIKey of pyrrolidin-1-ylurea;hydrate?
The InChIKey is PTWKEXYQYYEQKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11N3O.H2O/c6-5(9)7-8-3-1-2-4-8;/h1-4H2,(H3,6,7,9);1H2.
What are the key properties of pyrrolidin-1-ylurea;hydrate?
pyrrolidin-1-ylurea;hydrate has a molecular weight of 147.18 g/mol, XLogP of -1.16, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrolidin-1-ylurea;hydrate is sourced from PubChem (CID 141393036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).