C11H14F9N2P — CID 174842775
1-ethyl-3-methyl-2-(trifluoromethyl)-2H-benzimidazole;hydron;hexafluorophosphate (PubChem CID 174842775) has the molecular formula C11H14F9N2P and a molecular weight of 376.20 g/mol. Its IUPAC name is 1-ethyl-3-methyl-2-(trifluoromethyl)-2H-benzimidazole;hydron;hexafluorophosphate.
| Compound Name | 1-ethyl-3-methyl-2-(trifluoromethyl)-2H-benzimidazole;hydron;hexafluorophosphate |
|---|---|
| PubChem CID | 174842775 |
| Molecular Formula | C11H14F9N2P |
| Molecular Weight | 376.20 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | 1-ethyl-3-methyl-2-(trifluoromethyl)-2H-benzimidazole;hydron;hexafluorophosphate |
| SMILES | CCN1c2ccccc2N(C)C1C(F)(F)F.F[P-](F)(F)(F)(F)F.[H+] |
| InChI | InChI=1S/C11H13F3N2.F6P/c1-3-16-9-7-5-4-6-8(9)15(2)10(16)11(12,13)14;1-7(2,3,4,5)6/h4-7,10H,3H2,1-2H3;/q;-1/p+1 |
| InChIKey | OEOZNKKPDDQBNT-UHFFFAOYSA-O |
| XLogP | 6.35 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.20 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|