C14H20N2 — CID 167159789
1-(cyclobutylmethyl)-2,3-dimethyl-2H-benzimidazole (PubChem CID 167159789) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is 1-(cyclobutylmethyl)-2,3-dimethyl-2H-benzimidazole.
| Compound Name | 1-(cyclobutylmethyl)-2,3-dimethyl-2H-benzimidazole |
|---|---|
| PubChem CID | 167159789 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 1-(cyclobutylmethyl)-2,3-dimethyl-2H-benzimidazole |
| SMILES | CC1N(C)c2ccccc2N1CC1CCC1 |
| InChI | InChI=1S/C14H20N2/c1-11-15(2)13-8-3-4-9-14(13)16(11)10-12-6-5-7-12/h3-4,8-9,11-12H,5-7,10H2,1-2H3 |
| InChIKey | ZVLNFPHVYDJBRQ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |