C15H22N2 — CID 115318348
4-(cyclopentylmethyl)-3-methyl-2,3-dihydro-1H-quinoxaline (PubChem CID 115318348) has the molecular formula C15H22N2 and a molecular weight of 230.36 g/mol. Its IUPAC name is 4-(cyclopentylmethyl)-3-methyl-2,3-dihydro-1H-quinoxaline.
| Compound Name | 4-(cyclopentylmethyl)-3-methyl-2,3-dihydro-1H-quinoxaline |
|---|---|
| PubChem CID | 115318348 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.36 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 4-(cyclopentylmethyl)-3-methyl-2,3-dihydro-1H-quinoxaline |
| SMILES | CC1CNc2ccccc2N1CC1CCCC1 |
| InChI | InChI=1S/C15H22N2/c1-12-10-16-14-8-4-5-9-15(14)17(12)11-13-6-2-3-7-13/h4-5,8-9,12-13,16H,2-3,6-7,10-11H2,1H3 |
| InChIKey | TZURMTFSKVVICZ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.36 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |