About 4-[2-(2-methoxyethoxy)ethyl]-3-methyl-2,3-dihydro-1H-quinoxaline
4-[2-(2-methoxyethoxy)ethyl]-3-methyl-2,3-dihydro-1H-quinoxaline (PubChem CID 115318465) has the molecular formula C14H22N2O2
and a molecular weight of 250.34 g/mol. Its IUPAC name is 4-[2-(2-methoxyethoxy)ethyl]-3-methyl-2,3-dihydro-1H-quinoxaline.
Molecular Properties
| Compound Name | 4-[2-(2-methoxyethoxy)ethyl]-3-methyl-2,3-dihydro-1H-quinoxaline |
| PubChem CID | 115318465 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 4-[2-(2-methoxyethoxy)ethyl]-3-methyl-2,3-dihydro-1H-quinoxaline |
| SMILES | COCCOCCN1c2ccccc2NCC1C |
| InChI | InChI=1S/C14H22N2O2/c1-12-11-15-13-5-3-4-6-14(13)16(12)7-8-18-10-9-17-2/h3-6,12,15H,7-11H2,1-2H3 |
| InChIKey | UTOIDKHYVZVTQY-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-(2-methoxyethoxy)ethyl]-3-methyl-2,3-dihydro-1H-quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(2-methoxyethoxy)ethyl]-3-methyl-2,3-dihydro-1H-quinoxaline?
The IUPAC name of 4-[2-(2-methoxyethoxy)ethyl]-3-methyl-2,3-dihydro-1H-quinoxaline (CID 115318465) is 4-[2-(2-methoxyethoxy)ethyl]-3-methyl-2,3-dihydro-1H-quinoxaline.
What is the SMILES notation for 4-[2-(2-methoxyethoxy)ethyl]-3-methyl-2,3-dihydro-1H-quinoxaline?
The canonical SMILES for 4-[2-(2-methoxyethoxy)ethyl]-3-methyl-2,3-dihydro-1H-quinoxaline is COCCOCCN1c2ccccc2NCC1C.
What is the InChIKey of 4-[2-(2-methoxyethoxy)ethyl]-3-methyl-2,3-dihydro-1H-quinoxaline?
The InChIKey is UTOIDKHYVZVTQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N2O2/c1-12-11-15-13-5-3-4-6-14(13)16(12)7-8-18-10-9-17-2/h3-6,12,15H,7-11H2,1-2H3.
What are the key properties of 4-[2-(2-methoxyethoxy)ethyl]-3-methyl-2,3-dihydro-1H-quinoxaline?
4-[2-(2-methoxyethoxy)ethyl]-3-methyl-2,3-dihydro-1H-quinoxaline has a molecular weight of 250.34 g/mol, XLogP of 1.97, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(2-methoxyethoxy)ethyl]-3-methyl-2,3-dihydro-1H-quinoxaline is sourced from PubChem (CID 115318465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).