C17H24N2O4 — CID 174847583
(2-methoxypyrrolidin-1-yl) 3-(morpholin-4-ylmethyl)benzoate (PubChem CID 174847583) has the molecular formula C17H24N2O4 and a molecular weight of 320.39 g/mol. Its IUPAC name is (2-methoxypyrrolidin-1-yl) 3-(morpholin-4-ylmethyl)benzoate.
| Compound Name | (2-methoxypyrrolidin-1-yl) 3-(morpholin-4-ylmethyl)benzoate |
|---|---|
| PubChem CID | 174847583 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | (2-methoxypyrrolidin-1-yl) 3-(morpholin-4-ylmethyl)benzoate |
| SMILES | COC1CCCN1OC(=O)c1cccc(CN2CCOCC2)c1 |
| InChI | InChI=1S/C17H24N2O4/c1-21-16-6-3-7-19(16)23-17(20)15-5-2-4-14(12-15)13-18-8-10-22-11-9-18/h2,4-5,12,16H,3,6-11,13H2,1H3 |
| InChIKey | YVUMLBCPSXNWCP-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |