C8H13BrN2 — CID 174851128
1-(3-bromopropyl)-2,4-dimethylimidazole (PubChem CID 174851128) has the molecular formula C8H13BrN2 and a molecular weight of 217.11 g/mol. Its IUPAC name is 1-(3-bromopropyl)-2,4-dimethylimidazole.
| Compound Name | 1-(3-bromopropyl)-2,4-dimethylimidazole |
|---|---|
| PubChem CID | 174851128 |
| Molecular Formula | C8H13BrN2 |
| Molecular Weight | 217.11 g/mol |
| Exact Mass | 216.03 |
| IUPAC Name | 1-(3-bromopropyl)-2,4-dimethylimidazole |
| SMILES | Cc1cn(CCCBr)c(C)n1 |
| InChI | InChI=1S/C8H13BrN2/c1-7-6-11(5-3-4-9)8(2)10-7/h6H,3-5H2,1-2H3 |
| InChIKey | KPEYGCSZTLVRAN-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.11 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|