About 2-amino-4-(2,4-dimethylimidazol-1-yl)-2-methylbutanoic acid
2-amino-4-(2,4-dimethylimidazol-1-yl)-2-methylbutanoic acid (PubChem CID 165485276) has the molecular formula C10H17N3O2
and a molecular weight of 211.26 g/mol. Its IUPAC name is 2-amino-4-(2,4-dimethylimidazol-1-yl)-2-methylbutanoic acid.
Analyze 2-amino-4-(2,4-dimethylimidazol-1-yl)-2-methylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-(2,4-dimethylimidazol-1-yl)-2-methylbutanoic acid?
The IUPAC name of 2-amino-4-(2,4-dimethylimidazol-1-yl)-2-methylbutanoic acid (CID 165485276) is 2-amino-4-(2,4-dimethylimidazol-1-yl)-2-methylbutanoic acid.
What is the SMILES notation for 2-amino-4-(2,4-dimethylimidazol-1-yl)-2-methylbutanoic acid?
The canonical SMILES for 2-amino-4-(2,4-dimethylimidazol-1-yl)-2-methylbutanoic acid is Cc1cn(CCC(C)(N)C(=O)O)c(C)n1.
What is the InChIKey of 2-amino-4-(2,4-dimethylimidazol-1-yl)-2-methylbutanoic acid?
The InChIKey is ARNZWFRDMSXQPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3O2/c1-7-6-13(8(2)12-7)5-4-10(3,11)9(14)15/h6H,4-5,11H2,1-3H3,(H,14,15).
What are the key properties of 2-amino-4-(2,4-dimethylimidazol-1-yl)-2-methylbutanoic acid?
2-amino-4-(2,4-dimethylimidazol-1-yl)-2-methylbutanoic acid has a molecular weight of 211.26 g/mol, XLogP of 0.69, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-(2,4-dimethylimidazol-1-yl)-2-methylbutanoic acid is sourced from PubChem (CID 165485276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).