C20H28BN8- — CID 139089171
tetrakis(2,4-dimethylimidazol-1-yl)boranuide (PubChem CID 139089171) has the molecular formula C20H28BN8- and a molecular weight of 391.31 g/mol. Its IUPAC name is tetrakis(2,4-dimethylimidazol-1-yl)boranuide.
| Compound Name | tetrakis(2,4-dimethylimidazol-1-yl)boranuide |
|---|---|
| PubChem CID | 139089171 |
| Molecular Formula | C20H28BN8- |
| Molecular Weight | 391.31 g/mol |
| Exact Mass | 391.25 |
| IUPAC Name | tetrakis(2,4-dimethylimidazol-1-yl)boranuide |
| SMILES | Cc1cn([B-](n2cc(C)nc2C)(n2cc(C)nc2C)n2cc(C)nc2C)c(C)n1 |
| InChI | InChI=1S/C20H28BN8/c1-13-9-26(17(5)22-13)21(27-10-14(2)23-18(27)6,28-11-15(3)24-19(28)7)29-12-16(4)25-20(29)8/h9-12H,1-8H3/q-1 |
| InChIKey | PWJFCZYZMJROLO-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 71.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.31 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|