About 1-butyl-4-hydroxypiperazine;pyridine
1-butyl-4-hydroxypiperazine;pyridine (PubChem CID 174854405) has the molecular formula C13H23N3O
and a molecular weight of 237.35 g/mol. Its IUPAC name is 1-butyl-4-hydroxypiperazine;pyridine.
Molecular Properties
| Compound Name | 1-butyl-4-hydroxypiperazine;pyridine |
| PubChem CID | 174854405 |
| Molecular Formula | C13H23N3O |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.18 |
| IUPAC Name | 1-butyl-4-hydroxypiperazine;pyridine |
| SMILES | CCCCN1CCN(O)CC1.c1ccncc1 |
| InChI | InChI=1S/C8H18N2O.C5H5N/c1-2-3-4-9-5-7-10(11)8-6-9;1-2-4-6-5-3-1/h11H,2-8H2,1H3;1-5H |
| InChIKey | BYQGSSKKRJAMQL-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-butyl-4-hydroxypiperazine;pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-4-hydroxypiperazine;pyridine?
The IUPAC name of 1-butyl-4-hydroxypiperazine;pyridine (CID 174854405) is 1-butyl-4-hydroxypiperazine;pyridine.
What is the SMILES notation for 1-butyl-4-hydroxypiperazine;pyridine?
The canonical SMILES for 1-butyl-4-hydroxypiperazine;pyridine is CCCCN1CCN(O)CC1.c1ccncc1.
What is the InChIKey of 1-butyl-4-hydroxypiperazine;pyridine?
The InChIKey is BYQGSSKKRJAMQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2O.C5H5N/c1-2-3-4-9-5-7-10(11)8-6-9;1-2-4-6-5-3-1/h11H,2-8H2,1H3;1-5H.
What are the key properties of 1-butyl-4-hydroxypiperazine;pyridine?
1-butyl-4-hydroxypiperazine;pyridine has a molecular weight of 237.35 g/mol, XLogP of 1.87, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-4-hydroxypiperazine;pyridine is sourced from PubChem (CID 174854405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).