C22H43N3O — CID 174793053
N,N-dibutylbutan-1-amine;4-methylmorpholine;pyridine (PubChem CID 174793053) has the molecular formula C22H43N3O and a molecular weight of 365.61 g/mol. Its IUPAC name is N,N-dibutylbutan-1-amine;4-methylmorpholine;pyridine.
| Compound Name | N,N-dibutylbutan-1-amine;4-methylmorpholine;pyridine |
|---|---|
| PubChem CID | 174793053 |
| Molecular Formula | C22H43N3O |
| Molecular Weight | 365.61 g/mol |
| Exact Mass | 365.34 |
| IUPAC Name | N,N-dibutylbutan-1-amine;4-methylmorpholine;pyridine |
| SMILES | CCCCN(CCCC)CCCC.CN1CCOCC1.c1ccncc1 |
| InChI | InChI=1S/C12H27N.C5H11NO.C5H5N/c1-4-7-10-13(11-8-5-2)12-9-6-3;1-6-2-4-7-5-3-6;1-2-4-6-5-3-1/h4-12H2,1-3H3;2-5H2,1H3;1-5H |
| InChIKey | XUYFFXJOMDEKGL-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.61 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |