C15H34N2 — CID 174855758
1,2-dimethyl-1-tridecylhydrazine (PubChem CID 174855758) has the molecular formula C15H34N2 and a molecular weight of 242.45 g/mol. Its IUPAC name is 1,2-dimethyl-1-tridecylhydrazine.
| Compound Name | 1,2-dimethyl-1-tridecylhydrazine |
|---|---|
| PubChem CID | 174855758 |
| Molecular Formula | C15H34N2 |
| Molecular Weight | 242.45 g/mol |
| Exact Mass | 242.27 |
| IUPAC Name | 1,2-dimethyl-1-tridecylhydrazine |
| SMILES | CCCCCCCCCCCCCN(C)NC |
| InChI | InChI=1S/C15H34N2/c1-4-5-6-7-8-9-10-11-12-13-14-15-17(3)16-2/h16H,4-15H2,1-3H3 |
| InChIKey | VQCMEAGSJVIEMP-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.45 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|