C9H23N3 — CID 89271451
1-[(2,2-dimethylhydrazinyl)-methylamino]hexane (PubChem CID 89271451) has the molecular formula C9H23N3 and a molecular weight of 173.30 g/mol. Its IUPAC name is 1-[(2,2-dimethylhydrazinyl)-methylamino]hexane.
| Compound Name | 1-[(2,2-dimethylhydrazinyl)-methylamino]hexane |
|---|---|
| PubChem CID | 89271451 |
| Molecular Formula | C9H23N3 |
| Molecular Weight | 173.30 g/mol |
| Exact Mass | 173.19 |
| IUPAC Name | 1-[(2,2-dimethylhydrazinyl)-methylamino]hexane |
| SMILES | CCCCCCN(C)NN(C)C |
| InChI | InChI=1S/C9H23N3/c1-5-6-7-8-9-12(4)10-11(2)3/h10H,5-9H2,1-4H3 |
| InChIKey | HJGLLHBKWWRAJL-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.30 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|