C15H11Br2NO2 — CID 174857044
(2,7-dibromo-9H-fluoren-1-yl)methylcarbamic acid (PubChem CID 174857044) has the molecular formula C15H11Br2NO2 and a molecular weight of 397.07 g/mol. Its IUPAC name is (2,7-dibromo-9H-fluoren-1-yl)methylcarbamic acid.
| Compound Name | (2,7-dibromo-9H-fluoren-1-yl)methylcarbamic acid |
|---|---|
| PubChem CID | 174857044 |
| Molecular Formula | C15H11Br2NO2 |
| Molecular Weight | 397.07 g/mol |
| Exact Mass | 394.92 |
| IUPAC Name | (2,7-dibromo-9H-fluoren-1-yl)methylcarbamic acid |
| SMILES | O=C(O)NCc1c(Br)ccc2c1Cc1cc(Br)ccc1-2 |
| InChI | InChI=1S/C15H11Br2NO2/c16-9-1-2-10-8(5-9)6-12-11(10)3-4-14(17)13(12)7-18-15(19)20/h1-5,18H,6-7H2,(H,19,20) |
| InChIKey | ZNIVFLVJTZUSQO-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.07 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |