About 1-bromo-4-fluorobenzene;[5-fluoro-2-(4-fluorophenyl)phenyl]methylcarbamic acid
1-bromo-4-fluorobenzene;[5-fluoro-2-(4-fluorophenyl)phenyl]methylcarbamic acid (PubChem CID 69095609) has the molecular formula C20H15BrF3NO2
and a molecular weight of 438.24 g/mol. Its IUPAC name is 1-bromo-4-fluorobenzene;[5-fluoro-2-(4-fluorophenyl)phenyl]methylcarbamic acid.
Molecular Properties
| Compound Name | 1-bromo-4-fluorobenzene;[5-fluoro-2-(4-fluorophenyl)phenyl]methylcarbamic acid |
| PubChem CID | 69095609 |
| Molecular Formula | C20H15BrF3NO2 |
| Molecular Weight | 438.24 g/mol |
| Exact Mass | 437.02 |
| IUPAC Name | 1-bromo-4-fluorobenzene;[5-fluoro-2-(4-fluorophenyl)phenyl]methylcarbamic acid |
| SMILES | Fc1ccc(Br)cc1.O=C(O)NCc1cc(F)ccc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C14H11F2NO2.C6H4BrF/c15-11-3-1-9(2-4-11)13-6-5-12(16)7-10(13)8-17-14(18)19;7-5-1-3-6(8)4-2-5/h1-7,17H,8H2,(H,18,19);1-4H |
| InChIKey | CAIMVOXFRDNTGM-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 438.24 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-bromo-4-fluorobenzene;[5-fluoro-2-(4-fluorophenyl)phenyl]methylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-4-fluorobenzene;[5-fluoro-2-(4-fluorophenyl)phenyl]methylcarbamic acid?
The IUPAC name of 1-bromo-4-fluorobenzene;[5-fluoro-2-(4-fluorophenyl)phenyl]methylcarbamic acid (CID 69095609) is 1-bromo-4-fluorobenzene;[5-fluoro-2-(4-fluorophenyl)phenyl]methylcarbamic acid.
What is the SMILES notation for 1-bromo-4-fluorobenzene;[5-fluoro-2-(4-fluorophenyl)phenyl]methylcarbamic acid?
The canonical SMILES for 1-bromo-4-fluorobenzene;[5-fluoro-2-(4-fluorophenyl)phenyl]methylcarbamic acid is Fc1ccc(Br)cc1.O=C(O)NCc1cc(F)ccc1-c1ccc(F)cc1.
What is the InChIKey of 1-bromo-4-fluorobenzene;[5-fluoro-2-(4-fluorophenyl)phenyl]methylcarbamic acid?
The InChIKey is CAIMVOXFRDNTGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11F2NO2.C6H4BrF/c15-11-3-1-9(2-4-11)13-6-5-12(16)7-10(13)8-17-14(18)19;7-5-1-3-6(8)4-2-5/h1-7,17H,8H2,(H,18,19);1-4H.
What are the key properties of 1-bromo-4-fluorobenzene;[5-fluoro-2-(4-fluorophenyl)phenyl]methylcarbamic acid?
1-bromo-4-fluorobenzene;[5-fluoro-2-(4-fluorophenyl)phenyl]methylcarbamic acid has a molecular weight of 438.24 g/mol, XLogP of 5.99, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-4-fluorobenzene;[5-fluoro-2-(4-fluorophenyl)phenyl]methylcarbamic acid is sourced from PubChem (CID 69095609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).