C10H10BrF2NO2 — CID 159543729
[4-bromo-2-(2,2-difluoroethyl)phenyl]methylcarbamic acid (PubChem CID 159543729) has the molecular formula C10H10BrF2NO2 and a molecular weight of 294.10 g/mol. Its IUPAC name is [4-bromo-2-(2,2-difluoroethyl)phenyl]methylcarbamic acid.
| Compound Name | [4-bromo-2-(2,2-difluoroethyl)phenyl]methylcarbamic acid |
|---|---|
| PubChem CID | 159543729 |
| Molecular Formula | C10H10BrF2NO2 |
| Molecular Weight | 294.10 g/mol |
| Exact Mass | 292.99 |
| IUPAC Name | [4-bromo-2-(2,2-difluoroethyl)phenyl]methylcarbamic acid |
| SMILES | O=C(O)NCc1ccc(Br)cc1CC(F)F |
| InChI | InChI=1S/C10H10BrF2NO2/c11-8-2-1-6(5-14-10(15)16)7(3-8)4-9(12)13/h1-3,9,14H,4-5H2,(H,15,16) |
| InChIKey | MENODMXDFXYOME-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.10 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |