About 3-fluoro-1H-pyrrole;4-methylbenzenesulfonic acid;pyridine
3-fluoro-1H-pyrrole;4-methylbenzenesulfonic acid;pyridine (PubChem CID 174857376) has the molecular formula C16H17FN2O3S
and a molecular weight of 336.39 g/mol. Its IUPAC name is 3-fluoro-1H-pyrrole;4-methylbenzenesulfonic acid;pyridine.
Molecular Properties
| Compound Name | 3-fluoro-1H-pyrrole;4-methylbenzenesulfonic acid;pyridine |
| PubChem CID | 174857376 |
| Molecular Formula | C16H17FN2O3S |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 3-fluoro-1H-pyrrole;4-methylbenzenesulfonic acid;pyridine |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.Fc1cc[nH]c1.c1ccncc1 |
| InChI | InChI=1S/C7H8O3S.C5H5N.C4H4FN/c1-6-2-4-7(5-3-6)11(8,9)10;1-2-4-6-5-3-1;5-4-1-2-6-3-4/h2-5H,1H3,(H,8,9,10);1-5H;1-3,6H |
| InChIKey | MYPXQQNLNJPDRN-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 83.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 3-fluoro-1H-pyrrole;4-methylbenzenesulfonic acid;pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-1H-pyrrole;4-methylbenzenesulfonic acid;pyridine?
The IUPAC name of 3-fluoro-1H-pyrrole;4-methylbenzenesulfonic acid;pyridine (CID 174857376) is 3-fluoro-1H-pyrrole;4-methylbenzenesulfonic acid;pyridine.
What is the SMILES notation for 3-fluoro-1H-pyrrole;4-methylbenzenesulfonic acid;pyridine?
The canonical SMILES for 3-fluoro-1H-pyrrole;4-methylbenzenesulfonic acid;pyridine is Cc1ccc(S(=O)(=O)O)cc1.Fc1cc[nH]c1.c1ccncc1.
What is the InChIKey of 3-fluoro-1H-pyrrole;4-methylbenzenesulfonic acid;pyridine?
The InChIKey is MYPXQQNLNJPDRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O3S.C5H5N.C4H4FN/c1-6-2-4-7(5-3-6)11(8,9)10;1-2-4-6-5-3-1;5-4-1-2-6-3-4/h2-5H,1H3,(H,8,9,10);1-5H;1-3,6H.
What are the key properties of 3-fluoro-1H-pyrrole;4-methylbenzenesulfonic acid;pyridine?
3-fluoro-1H-pyrrole;4-methylbenzenesulfonic acid;pyridine has a molecular weight of 336.39 g/mol, XLogP of 3.48, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-1H-pyrrole;4-methylbenzenesulfonic acid;pyridine is sourced from PubChem (CID 174857376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).