C7H13N3 — CID 174857851
1,3-di(propylidene)guanidine (PubChem CID 174857851) has the molecular formula C7H13N3 and a molecular weight of 139.20 g/mol. Its IUPAC name is 1,3-di(propylidene)guanidine.
| Compound Name | 1,3-di(propylidene)guanidine |
|---|---|
| PubChem CID | 174857851 |
| Molecular Formula | C7H13N3 |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.11 |
| IUPAC Name | 1,3-di(propylidene)guanidine |
| SMILES | [H]N=C(N=CCC)N=CCC |
| InChI | InChI=1S/C7H13N3/c1-3-5-9-7(8)10-6-4-2/h5-6,8H,3-4H2,1-2H3 |
| InChIKey | XGCATXQEJBMDAP-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 48.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|