C11H24N4O — CID 174858599
1,3-diamino-1-(2-butylcyclohexyl)urea (PubChem CID 174858599) has the molecular formula C11H24N4O and a molecular weight of 228.34 g/mol. Its IUPAC name is 1,3-diamino-1-(2-butylcyclohexyl)urea.
| Compound Name | 1,3-diamino-1-(2-butylcyclohexyl)urea |
|---|---|
| PubChem CID | 174858599 |
| Molecular Formula | C11H24N4O |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.20 |
| IUPAC Name | 1,3-diamino-1-(2-butylcyclohexyl)urea |
| SMILES | CCCCC1CCCCC1N(N)C(=O)NN |
| InChI | InChI=1S/C11H24N4O/c1-2-3-6-9-7-4-5-8-10(9)15(13)11(16)14-12/h9-10H,2-8,12-13H2,1H3,(H,14,16) |
| InChIKey | COLNURXKQMKKIV-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 84.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|