C16H24F2N4O2 — CID 174859705
3,4-difluoro-N-piperidin-4-ylbenzamide;piperazin-2-ol (PubChem CID 174859705) has the molecular formula C16H24F2N4O2 and a molecular weight of 342.39 g/mol. Its IUPAC name is 3,4-difluoro-N-piperidin-4-ylbenzamide;piperazin-2-ol.
| Compound Name | 3,4-difluoro-N-piperidin-4-ylbenzamide;piperazin-2-ol |
|---|---|
| PubChem CID | 174859705 |
| Molecular Formula | C16H24F2N4O2 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | 3,4-difluoro-N-piperidin-4-ylbenzamide;piperazin-2-ol |
| SMILES | O=C(NC1CCNCC1)c1ccc(F)c(F)c1.OC1CNCCN1 |
| InChI | InChI=1S/C12H14F2N2O.C4H10N2O/c13-10-2-1-8(7-11(10)14)12(17)16-9-3-5-15-6-4-9;7-4-3-5-1-2-6-4/h1-2,7,9,15H,3-6H2,(H,16,17);4-7H,1-3H2 |
| InChIKey | OFJFUYWNOAQZIW-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 85.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |