About octanoic acid;tetraethylazanium;hydrobromide
octanoic acid;tetraethylazanium;hydrobromide (PubChem CID 174863732) has the molecular formula C16H37BrNO2+
and a molecular weight of 355.38 g/mol. Its IUPAC name is octanoic acid;tetraethylazanium;hydrobromide.
Molecular Properties
| Compound Name | octanoic acid;tetraethylazanium;hydrobromide |
| PubChem CID | 174863732 |
| Molecular Formula | C16H37BrNO2+ |
| Molecular Weight | 355.38 g/mol |
| Exact Mass | 354.20 |
| IUPAC Name | octanoic acid;tetraethylazanium;hydrobromide |
| SMILES | Br.CCCCCCCC(=O)O.CC[N+](CC)(CC)CC |
| InChI | InChI=1S/C8H20N.C8H16O2.BrH/c1-5-9(6-2,7-3)8-4;1-2-3-4-5-6-7-8(9)10;/h5-8H2,1-4H3;2-7H2,1H3,(H,9,10);1H/q+1;; |
| InChIKey | BIKANWLQWLIPRH-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.38 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze octanoic acid;tetraethylazanium;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octanoic acid;tetraethylazanium;hydrobromide?
The IUPAC name of octanoic acid;tetraethylazanium;hydrobromide (CID 174863732) is octanoic acid;tetraethylazanium;hydrobromide.
What is the SMILES notation for octanoic acid;tetraethylazanium;hydrobromide?
The canonical SMILES for octanoic acid;tetraethylazanium;hydrobromide is Br.CCCCCCCC(=O)O.CC[N+](CC)(CC)CC.
What is the InChIKey of octanoic acid;tetraethylazanium;hydrobromide?
The InChIKey is BIKANWLQWLIPRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H20N.C8H16O2.BrH/c1-5-9(6-2,7-3)8-4;1-2-3-4-5-6-7-8(9)10;/h5-8H2,1-4H3;2-7H2,1H3,(H,9,10);1H/q+1;;.
What are the key properties of octanoic acid;tetraethylazanium;hydrobromide?
octanoic acid;tetraethylazanium;hydrobromide has a molecular weight of 355.38 g/mol, XLogP of 4.89, 10 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for octanoic acid;tetraethylazanium;hydrobromide is sourced from PubChem (CID 174863732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).