C16H25N3O2S — CID 174867647
N-(cyclohexylmethyl)-3-(pentanoylamino)-1,2-thiazole-5-carboxamide (PubChem CID 174867647) has the molecular formula C16H25N3O2S and a molecular weight of 323.46 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-3-(pentanoylamino)-1,2-thiazole-5-carboxamide.
| Compound Name | N-(cyclohexylmethyl)-3-(pentanoylamino)-1,2-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 174867647 |
| Molecular Formula | C16H25N3O2S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | N-(cyclohexylmethyl)-3-(pentanoylamino)-1,2-thiazole-5-carboxamide |
| SMILES | CCCCC(=O)Nc1cc(C(=O)NCC2CCCCC2)sn1 |
| InChI | InChI=1S/C16H25N3O2S/c1-2-3-9-15(20)18-14-10-13(22-19-14)16(21)17-11-12-7-5-4-6-8-12/h10,12H,2-9,11H2,1H3,(H,17,21)(H,18,19,20) |
| InChIKey | CLKIMTLXRYAFKW-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |