About potassium;carbamoyl formate;hydride
potassium;carbamoyl formate;hydride (PubChem CID 174868765) has the molecular formula C2H4KNO3
and a molecular weight of 129.16 g/mol. Its IUPAC name is potassium;carbamoyl formate;hydride.
Molecular Properties
| Compound Name | potassium;carbamoyl formate;hydride |
| PubChem CID | 174868765 |
| Molecular Formula | C2H4KNO3 |
| Molecular Weight | 129.16 g/mol |
| Exact Mass | 128.98 |
| IUPAC Name | potassium;carbamoyl formate;hydride |
| SMILES | NC(=O)OC=O.[H-].[K+] |
| InChI | InChI=1S/C2H3NO3.K.H/c3-2(5)6-1-4;;/h1H,(H2,3,5);;/q;+1;-1 |
| InChIKey | WIOIHZPJZCLZNA-UHFFFAOYSA-N |
| XLogP | -3.65 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.16 |
| LogP ≤ 5 | -3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze potassium;carbamoyl formate;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;carbamoyl formate;hydride?
The IUPAC name of potassium;carbamoyl formate;hydride (CID 174868765) is potassium;carbamoyl formate;hydride.
What is the SMILES notation for potassium;carbamoyl formate;hydride?
The canonical SMILES for potassium;carbamoyl formate;hydride is NC(=O)OC=O.[H-].[K+].
What is the InChIKey of potassium;carbamoyl formate;hydride?
The InChIKey is WIOIHZPJZCLZNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H3NO3.K.H/c3-2(5)6-1-4;;/h1H,(H2,3,5);;/q;+1;-1.
What are the key properties of potassium;carbamoyl formate;hydride?
potassium;carbamoyl formate;hydride has a molecular weight of 129.16 g/mol, XLogP of -3.65, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;carbamoyl formate;hydride is sourced from PubChem (CID 174868765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).