C21H28N2O5 — CID 174873775
2,4-bis[4-(dimethylamino)phenyl]-1,1,5,5-tetrahydroxypentan-3-one (PubChem CID 174873775) has the molecular formula C21H28N2O5 and a molecular weight of 388.46 g/mol. Its IUPAC name is 2,4-bis[4-(dimethylamino)phenyl]-1,1,5,5-tetrahydroxypentan-3-one.
| Compound Name | 2,4-bis[4-(dimethylamino)phenyl]-1,1,5,5-tetrahydroxypentan-3-one |
|---|---|
| PubChem CID | 174873775 |
| Molecular Formula | C21H28N2O5 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | 2,4-bis[4-(dimethylamino)phenyl]-1,1,5,5-tetrahydroxypentan-3-one |
| SMILES | CN(C)c1ccc(C(C(=O)C(c2ccc(N(C)C)cc2)C(O)O)C(O)O)cc1 |
| InChI | InChI=1S/C21H28N2O5/c1-22(2)15-9-5-13(6-10-15)17(20(25)26)19(24)18(21(27)28)14-7-11-16(12-8-14)23(3)4/h5-12,17-18,20-21,25-28H,1-4H3 |
| InChIKey | AHKQGWZBJZXRFS-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 104.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|