C15H29NSi — CID 174880096
4-(1,1,2-triethylsilinan-2-yl)butanenitrile (PubChem CID 174880096) has the molecular formula C15H29NSi and a molecular weight of 251.49 g/mol. Its IUPAC name is 4-(1,1,2-triethylsilinan-2-yl)butanenitrile.
| Compound Name | 4-(1,1,2-triethylsilinan-2-yl)butanenitrile |
|---|---|
| PubChem CID | 174880096 |
| Molecular Formula | C15H29NSi |
| Molecular Weight | 251.49 g/mol |
| Exact Mass | 251.21 |
| IUPAC Name | 4-(1,1,2-triethylsilinan-2-yl)butanenitrile |
| SMILES | CCC1(CCCC#N)CCCC[Si]1(CC)CC |
| InChI | InChI=1S/C15H29NSi/c1-4-15(11-7-9-13-16)12-8-10-14-17(15,5-2)6-3/h4-12,14H2,1-3H3 |
| InChIKey | UUPRFTTWGGVCTI-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.49 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|