About 2-acetamidoacetic acid;octanoic acid
2-acetamidoacetic acid;octanoic acid (PubChem CID 174885803) has the molecular formula C12H23NO5
and a molecular weight of 261.32 g/mol. Its IUPAC name is 2-acetamidoacetic acid;octanoic acid.
Molecular Properties
| Compound Name | 2-acetamidoacetic acid;octanoic acid |
| PubChem CID | 174885803 |
| Molecular Formula | C12H23NO5 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.16 |
| IUPAC Name | 2-acetamidoacetic acid;octanoic acid |
| SMILES | CC(=O)NCC(=O)O.CCCCCCCC(=O)O |
| InChI | InChI=1S/C8H16O2.C4H7NO3/c1-2-3-4-5-6-7-8(9)10;1-3(6)5-2-4(7)8/h2-7H2,1H3,(H,9,10);2H2,1H3,(H,5,6)(H,7,8) |
| InChIKey | YXAXQVSYWFAKSI-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-acetamidoacetic acid;octanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetamidoacetic acid;octanoic acid?
The IUPAC name of 2-acetamidoacetic acid;octanoic acid (CID 174885803) is 2-acetamidoacetic acid;octanoic acid.
What is the SMILES notation for 2-acetamidoacetic acid;octanoic acid?
The canonical SMILES for 2-acetamidoacetic acid;octanoic acid is CC(=O)NCC(=O)O.CCCCCCCC(=O)O.
What is the InChIKey of 2-acetamidoacetic acid;octanoic acid?
The InChIKey is YXAXQVSYWFAKSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O2.C4H7NO3/c1-2-3-4-5-6-7-8(9)10;1-3(6)5-2-4(7)8/h2-7H2,1H3,(H,9,10);2H2,1H3,(H,5,6)(H,7,8).
What are the key properties of 2-acetamidoacetic acid;octanoic acid?
2-acetamidoacetic acid;octanoic acid has a molecular weight of 261.32 g/mol, XLogP of 1.64, 8 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetamidoacetic acid;octanoic acid is sourced from PubChem (CID 174885803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).