C9H18ClNO — CID 174886040
azane;3-prop-2-enylhexa-2,5-dien-1-ol;hydrochloride (PubChem CID 174886040) has the molecular formula C9H18ClNO and a molecular weight of 191.70 g/mol. Its IUPAC name is azane;3-prop-2-enylhexa-2,5-dien-1-ol;hydrochloride.
| Compound Name | azane;3-prop-2-enylhexa-2,5-dien-1-ol;hydrochloride |
|---|---|
| PubChem CID | 174886040 |
| Molecular Formula | C9H18ClNO |
| Molecular Weight | 191.70 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | azane;3-prop-2-enylhexa-2,5-dien-1-ol;hydrochloride |
| SMILES | C=CCC(=CCO)CC=C.Cl.N |
| InChI | InChI=1S/C9H14O.ClH.H3N/c1-3-5-9(6-4-2)7-8-10;;/h3-4,7,10H,1-2,5-6,8H2;1H;1H3 |
| InChIKey | IDTSJJRXYJRQAP-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 55.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.70 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|