C6H9IO — CID 101020716
(2Z)-3-iodohexa-2,5-dien-1-ol (PubChem CID 101020716) has the molecular formula C6H9IO and a molecular weight of 224.04 g/mol. Its IUPAC name is (2Z)-3-iodohexa-2,5-dien-1-ol.
| Compound Name | (2Z)-3-iodohexa-2,5-dien-1-ol |
|---|---|
| PubChem CID | 101020716 |
| Molecular Formula | C6H9IO |
| Molecular Weight | 224.04 g/mol |
| Exact Mass | 223.97 |
| IUPAC Name | (2Z)-3-iodohexa-2,5-dien-1-ol |
| SMILES | C=CC/C(I)=C/CO |
| InChI | InChI=1S/C6H9IO/c1-2-3-6(7)4-5-8/h2,4,8H,1,3,5H2/b6-4- |
| InChIKey | WUYLJQRIBXQDGH-XQRVVYSFSA-N |
| XLogP | 1.87 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.04 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|