C6H9I — CID 88547743
(4Z)-4-iodohexa-1,4-diene (PubChem CID 88547743) has the molecular formula C6H9I and a molecular weight of 208.04 g/mol. Its IUPAC name is (4Z)-4-iodohexa-1,4-diene.
| Compound Name | (4Z)-4-iodohexa-1,4-diene |
|---|---|
| PubChem CID | 88547743 |
| Molecular Formula | C6H9I |
| Molecular Weight | 208.04 g/mol |
| Exact Mass | 207.97 |
| IUPAC Name | (4Z)-4-iodohexa-1,4-diene |
| SMILES | C=CC/C(I)=C/C |
| InChI | InChI=1S/C6H9I/c1-3-5-6(7)4-2/h3-4H,1,5H2,2H3/b6-4- |
| InChIKey | NUSRBHZFYCTWBW-XQRVVYSFSA-N |
| XLogP | 2.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.04 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|