1-methoxy-2-(3-methoxyphenyl)hydrazine;phosphoric acid

C8H15N2O6P — CID 174886851

IUPAC1-methoxy-2-(3-methoxyphenyl)hydrazine;phosphoric acid
SMILESCONNc1cccc(OC)c1.O=P(O)(O)O
InChIInChI=1S/C8H12N2O2.H3O4P/c1-11-8-5-3-4-7(6-8)9-10-12-2;1-5(2,3)4/h3-6,9-10H,1-2H3;(H3,1,2,3,4)
InChIKeyYLYRASWHVPSMNA-UHFFFAOYSA-N
MW266.19 g/mol
LogP0.24
Rot. Bonds4

About 1-methoxy-2-(3-methoxyphenyl)hydrazine;phosphoric acid

1-methoxy-2-(3-methoxyphenyl)hydrazine;phosphoric acid (PubChem CID 174886851) has the molecular formula C8H15N2O6P and a molecular weight of 266.19 g/mol. Its IUPAC name is 1-methoxy-2-(3-methoxyphenyl)hydrazine;phosphoric acid.

Molecular Properties

Compound Name1-methoxy-2-(3-methoxyphenyl)hydrazine;phosphoric acid
PubChem CID174886851
Molecular FormulaC8H15N2O6P
Molecular Weight266.19 g/mol
Exact Mass266.07
IUPAC Name1-methoxy-2-(3-methoxyphenyl)hydrazine;phosphoric acid
SMILESCONNc1cccc(OC)c1.O=P(O)(O)O
InChIInChI=1S/C8H12N2O2.H3O4P/c1-11-8-5-3-4-7(6-8)9-10-12-2;1-5(2,3)4/h3-6,9-10H,1-2H3;(H3,1,2,3,4)
InChIKeyYLYRASWHVPSMNA-UHFFFAOYSA-N
XLogP0.24
TPSA120.28 Ų
H-Bond Donors5
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500266.19
LogP ≤ 50.24
H-Bond Donors ≤ 55
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze 1-methoxy-2-(3-methoxyphenyl)hydrazine;phosphoric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-methoxy-2-(3-methoxyphenyl)hydrazine;phosphoric acid?
The IUPAC name of 1-methoxy-2-(3-methoxyphenyl)hydrazine;phosphoric acid (CID 174886851) is 1-methoxy-2-(3-methoxyphenyl)hydrazine;phosphoric acid.
What is the SMILES notation for 1-methoxy-2-(3-methoxyphenyl)hydrazine;phosphoric acid?
The canonical SMILES for 1-methoxy-2-(3-methoxyphenyl)hydrazine;phosphoric acid is CONNc1cccc(OC)c1.O=P(O)(O)O.
What is the InChIKey of 1-methoxy-2-(3-methoxyphenyl)hydrazine;phosphoric acid?
The InChIKey is YLYRASWHVPSMNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2.H3O4P/c1-11-8-5-3-4-7(6-8)9-10-12-2;1-5(2,3)4/h3-6,9-10H,1-2H3;(H3,1,2,3,4).
What are the key properties of 1-methoxy-2-(3-methoxyphenyl)hydrazine;phosphoric acid?
1-methoxy-2-(3-methoxyphenyl)hydrazine;phosphoric acid has a molecular weight of 266.19 g/mol, XLogP of 0.24, 4 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-2-(3-methoxyphenyl)hydrazine;phosphoric acid is sourced from PubChem (CID 174886851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).