About 1-methoxy-2-(3-methoxyphenyl)hydrazine;phosphoric acid
1-methoxy-2-(3-methoxyphenyl)hydrazine;phosphoric acid (PubChem CID 174886851) has the molecular formula C8H15N2O6P
and a molecular weight of 266.19 g/mol. Its IUPAC name is 1-methoxy-2-(3-methoxyphenyl)hydrazine;phosphoric acid.
Molecular Properties
| Compound Name | 1-methoxy-2-(3-methoxyphenyl)hydrazine;phosphoric acid |
| PubChem CID | 174886851 |
| Molecular Formula | C8H15N2O6P |
| Molecular Weight | 266.19 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 1-methoxy-2-(3-methoxyphenyl)hydrazine;phosphoric acid |
| SMILES | CONNc1cccc(OC)c1.O=P(O)(O)O |
| InChI | InChI=1S/C8H12N2O2.H3O4P/c1-11-8-5-3-4-7(6-8)9-10-12-2;1-5(2,3)4/h3-6,9-10H,1-2H3;(H3,1,2,3,4) |
| InChIKey | YLYRASWHVPSMNA-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 120.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.19 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxy-2-(3-methoxyphenyl)hydrazine;phosphoric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxy-2-(3-methoxyphenyl)hydrazine;phosphoric acid?
The IUPAC name of 1-methoxy-2-(3-methoxyphenyl)hydrazine;phosphoric acid (CID 174886851) is 1-methoxy-2-(3-methoxyphenyl)hydrazine;phosphoric acid.
What is the SMILES notation for 1-methoxy-2-(3-methoxyphenyl)hydrazine;phosphoric acid?
The canonical SMILES for 1-methoxy-2-(3-methoxyphenyl)hydrazine;phosphoric acid is CONNc1cccc(OC)c1.O=P(O)(O)O.
What is the InChIKey of 1-methoxy-2-(3-methoxyphenyl)hydrazine;phosphoric acid?
The InChIKey is YLYRASWHVPSMNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2.H3O4P/c1-11-8-5-3-4-7(6-8)9-10-12-2;1-5(2,3)4/h3-6,9-10H,1-2H3;(H3,1,2,3,4).
What are the key properties of 1-methoxy-2-(3-methoxyphenyl)hydrazine;phosphoric acid?
1-methoxy-2-(3-methoxyphenyl)hydrazine;phosphoric acid has a molecular weight of 266.19 g/mol, XLogP of 0.24, 4 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-2-(3-methoxyphenyl)hydrazine;phosphoric acid is sourced from PubChem (CID 174886851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).