About 2-[bis(2-hydroxyethyl)amino]ethanol;2-methylbenzenesulfonic acid
2-[bis(2-hydroxyethyl)amino]ethanol;2-methylbenzenesulfonic acid (PubChem CID 174886922) has the molecular formula C13H23NO6S
and a molecular weight of 321.39 g/mol. Its IUPAC name is 2-[bis(2-hydroxyethyl)amino]ethanol;2-methylbenzenesulfonic acid.
Molecular Properties
| Compound Name | 2-[bis(2-hydroxyethyl)amino]ethanol;2-methylbenzenesulfonic acid |
| PubChem CID | 174886922 |
| Molecular Formula | C13H23NO6S |
| Molecular Weight | 321.39 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | 2-[bis(2-hydroxyethyl)amino]ethanol;2-methylbenzenesulfonic acid |
| SMILES | Cc1ccccc1S(=O)(=O)O.OCCN(CCO)CCO |
| InChI | InChI=1S/C7H8O3S.C6H15NO3/c1-6-4-2-3-5-7(6)11(8,9)10;8-4-1-7(2-5-9)3-6-10/h2-5H,1H3,(H,8,9,10);8-10H,1-6H2 |
| InChIKey | OSMSUYYXHQXKAX-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 118.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.39 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[bis(2-hydroxyethyl)amino]ethanol;2-methylbenzenesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[bis(2-hydroxyethyl)amino]ethanol;2-methylbenzenesulfonic acid?
The IUPAC name of 2-[bis(2-hydroxyethyl)amino]ethanol;2-methylbenzenesulfonic acid (CID 174886922) is 2-[bis(2-hydroxyethyl)amino]ethanol;2-methylbenzenesulfonic acid.
What is the SMILES notation for 2-[bis(2-hydroxyethyl)amino]ethanol;2-methylbenzenesulfonic acid?
The canonical SMILES for 2-[bis(2-hydroxyethyl)amino]ethanol;2-methylbenzenesulfonic acid is Cc1ccccc1S(=O)(=O)O.OCCN(CCO)CCO.
What is the InChIKey of 2-[bis(2-hydroxyethyl)amino]ethanol;2-methylbenzenesulfonic acid?
The InChIKey is OSMSUYYXHQXKAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O3S.C6H15NO3/c1-6-4-2-3-5-7(6)11(8,9)10;8-4-1-7(2-5-9)3-6-10/h2-5H,1H3,(H,8,9,10);8-10H,1-6H2.
What are the key properties of 2-[bis(2-hydroxyethyl)amino]ethanol;2-methylbenzenesulfonic acid?
2-[bis(2-hydroxyethyl)amino]ethanol;2-methylbenzenesulfonic acid has a molecular weight of 321.39 g/mol, XLogP of -0.49, 7 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[bis(2-hydroxyethyl)amino]ethanol;2-methylbenzenesulfonic acid is sourced from PubChem (CID 174886922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).