About N-[5-(2,4-dichlorophenyl)-1,7-naphthyridin-3-yl]formamide
N-[5-(2,4-dichlorophenyl)-1,7-naphthyridin-3-yl]formamide (PubChem CID 174888346) has the molecular formula C15H9Cl2N3O
and a molecular weight of 318.16 g/mol. Its IUPAC name is N-[5-(2,4-dichlorophenyl)-1,7-naphthyridin-3-yl]formamide.
Molecular Properties
| Compound Name | N-[5-(2,4-dichlorophenyl)-1,7-naphthyridin-3-yl]formamide |
| PubChem CID | 174888346 |
| Molecular Formula | C15H9Cl2N3O |
| Molecular Weight | 318.16 g/mol |
| Exact Mass | 317.01 |
| IUPAC Name | N-[5-(2,4-dichlorophenyl)-1,7-naphthyridin-3-yl]formamide |
| SMILES | O=CNc1cnc2cncc(-c3ccc(Cl)cc3Cl)c2c1 |
| InChI | InChI=1S/C15H9Cl2N3O/c16-9-1-2-11(14(17)3-9)13-6-18-7-15-12(13)4-10(5-19-15)20-8-21/h1-8H,(H,20,21) |
| InChIKey | RWEVUNIGNRNLBY-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.16 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-[5-(2,4-dichlorophenyl)-1,7-naphthyridin-3-yl]formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-(2,4-dichlorophenyl)-1,7-naphthyridin-3-yl]formamide?
The IUPAC name of N-[5-(2,4-dichlorophenyl)-1,7-naphthyridin-3-yl]formamide (CID 174888346) is N-[5-(2,4-dichlorophenyl)-1,7-naphthyridin-3-yl]formamide.
What is the SMILES notation for N-[5-(2,4-dichlorophenyl)-1,7-naphthyridin-3-yl]formamide?
The canonical SMILES for N-[5-(2,4-dichlorophenyl)-1,7-naphthyridin-3-yl]formamide is O=CNc1cnc2cncc(-c3ccc(Cl)cc3Cl)c2c1.
What is the InChIKey of N-[5-(2,4-dichlorophenyl)-1,7-naphthyridin-3-yl]formamide?
The InChIKey is RWEVUNIGNRNLBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9Cl2N3O/c16-9-1-2-11(14(17)3-9)13-6-18-7-15-12(13)4-10(5-19-15)20-8-21/h1-8H,(H,20,21).
What are the key properties of N-[5-(2,4-dichlorophenyl)-1,7-naphthyridin-3-yl]formamide?
N-[5-(2,4-dichlorophenyl)-1,7-naphthyridin-3-yl]formamide has a molecular weight of 318.16 g/mol, XLogP of 4.17, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-(2,4-dichlorophenyl)-1,7-naphthyridin-3-yl]formamide is sourced from PubChem (CID 174888346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).