C13H22N2O5S2-2 — CID 174890341
[1-[4-(sulfinatomethyl)piperidine-1-carbonyl]piperidin-4-yl]methanesulfinate (PubChem CID 174890341) has the molecular formula C13H22N2O5S2-2 and a molecular weight of 350.46 g/mol. Its IUPAC name is [1-[4-(sulfinatomethyl)piperidine-1-carbonyl]piperidin-4-yl]methanesulfinate.
| Compound Name | [1-[4-(sulfinatomethyl)piperidine-1-carbonyl]piperidin-4-yl]methanesulfinate |
|---|---|
| PubChem CID | 174890341 |
| Molecular Formula | C13H22N2O5S2-2 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | [1-[4-(sulfinatomethyl)piperidine-1-carbonyl]piperidin-4-yl]methanesulfinate |
| SMILES | O=C(N1CCC(CS(=O)[O-])CC1)N1CCC(CS(=O)[O-])CC1 |
| InChI | InChI=1S/C13H24N2O5S2/c16-13(14-5-1-11(2-6-14)9-21(17)18)15-7-3-12(4-8-15)10-22(19)20/h11-12H,1-10H2,(H,17,18)(H,19,20)/p-2 |
| InChIKey | WWDZMCVPTXBOCN-UHFFFAOYSA-L |
| XLogP | 0.29 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|