About N,N-dimethylformamide;1-hydroxytriazole
N,N-dimethylformamide;1-hydroxytriazole (PubChem CID 174891213) has the molecular formula C5H10N4O2
and a molecular weight of 158.16 g/mol. Its IUPAC name is N,N-dimethylformamide;1-hydroxytriazole.
Molecular Properties
| Compound Name | N,N-dimethylformamide;1-hydroxytriazole |
| PubChem CID | 174891213 |
| Molecular Formula | C5H10N4O2 |
| Molecular Weight | 158.16 g/mol |
| Exact Mass | 158.08 |
| IUPAC Name | N,N-dimethylformamide;1-hydroxytriazole |
| SMILES | CN(C)C=O.On1ccnn1 |
| InChI | InChI=1S/C3H7NO.C2H3N3O/c1-4(2)3-5;6-5-2-1-3-4-5/h3H,1-2H3;1-2,6H |
| InChIKey | TYCYQGOTJNIROC-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.16 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethylformamide;1-hydroxytriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylformamide;1-hydroxytriazole?
The IUPAC name of N,N-dimethylformamide;1-hydroxytriazole (CID 174891213) is N,N-dimethylformamide;1-hydroxytriazole.
What is the SMILES notation for N,N-dimethylformamide;1-hydroxytriazole?
The canonical SMILES for N,N-dimethylformamide;1-hydroxytriazole is CN(C)C=O.On1ccnn1.
What is the InChIKey of N,N-dimethylformamide;1-hydroxytriazole?
The InChIKey is TYCYQGOTJNIROC-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NO.C2H3N3O/c1-4(2)3-5;6-5-2-1-3-4-5/h3H,1-2H3;1-2,6H.
What are the key properties of N,N-dimethylformamide;1-hydroxytriazole?
N,N-dimethylformamide;1-hydroxytriazole has a molecular weight of 158.16 g/mol, XLogP of -0.78, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylformamide;1-hydroxytriazole is sourced from PubChem (CID 174891213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).