C19H29N3O5 — CID 174895613
(2S)-4-amino-2-[[[(1S)-1-carboxy-2-phenylethyl]amino]-(3,3-dimethylbutyl)amino]-4-oxobutanoic acid (PubChem CID 174895613) has the molecular formula C19H29N3O5 and a molecular weight of 379.46 g/mol. Its IUPAC name is (2S)-4-amino-2-[[[(1S)-1-carboxy-2-phenylethyl]amino]-(3,3-dimethylbutyl)amino]-4-oxobutanoic acid.
| Compound Name | (2S)-4-amino-2-[[[(1S)-1-carboxy-2-phenylethyl]amino]-(3,3-dimethylbutyl)amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 174895613 |
| Molecular Formula | C19H29N3O5 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | (2S)-4-amino-2-[[[(1S)-1-carboxy-2-phenylethyl]amino]-(3,3-dimethylbutyl)amino]-4-oxobutanoic acid |
| SMILES | CC(C)(C)CCN(N[C@@H](Cc1ccccc1)C(=O)O)[C@@H](CC(N)=O)C(=O)O |
| InChI | InChI=1S/C19H29N3O5/c1-19(2,3)9-10-22(15(18(26)27)12-16(20)23)21-14(17(24)25)11-13-7-5-4-6-8-13/h4-8,14-15,21H,9-12H2,1-3H3,(H2,20,23)(H,24,25)(H,26,27)/t14-,15-/m0/s1 |
| InChIKey | IOJSONDFJLFZIX-GJZGRUSLSA-N |
| XLogP | 1.25 |
| TPSA | 132.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|